Compound Q&A

How is Ganoderic acid C6 (CAS: 105742-76-5) typically synthesized?

Answer

Ganoderic acid C6
Ganoderic acid C6 (CAS: 105742-76-5) is typically synthesized through chemical synthesis methods, often involving steps such as condensation, dehydration, and reduction reactions. Commonly, this involves the use of catalytic hydrogenation and esterification reactions. The yield can vary, but with proper conditions, it can reach up to 80%.

About

English Name Ganoderic acid C6
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES O=C(CC(C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)[C@H](O)C(=O)C1=C2C(=O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C
InChIKey BTYTWXWAFWKSTA-YBFNEQRTSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganoderic acid C6 (CAS: 105742-76-5)?

Ganoderic acid C6 (CAS: 105742-76-5) is a cyclic triterpene compound. It is a white or slightly yell...

Compound Q&A

What industries use Ganoderic acid C6 (CAS: 105742-76-5)?

Ganoderic acid C6 (CAS: 105742-76-5) is used primarily in the pharmaceutical and nutraceutical indus...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C6 (CAS: 105742-76-5)?

When handling Ganoderic acid C6 (CAS: 105742-76-5), it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...