Compound Q&A

What are the physical and chemical properties of Ganoderic acid C6 (CAS: 105742-76-5)?

Answer

Ganoderic acid C6
Ganoderic acid C6 (CAS: 105742-76-5) is a cyclic triterpene compound. It is a white or slightly yellow crystalline powder with a molecular weight of approximately 616.38 g/mol. It is poorly soluble in water but soluble in ethanol and methanol. Chemically, it is relatively stable under normal conditions but can degrade under strong acid or base conditions. It exhibits antioxidant and anti-inflammatory activities.

About

English Name Ganoderic acid C6
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES O=C(CC(C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)[C@H](O)C(=O)C1=C2C(=O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C
InChIKey BTYTWXWAFWKSTA-YBFNEQRTSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is Ganoderic acid C6 (CAS: 105742-76-5) typically synthesized?

Ganoderic acid C6 (CAS: 105742-76-5) is typically synthesized through chemical synthesis methods, of...

Compound Q&A

What industries use Ganoderic acid C6 (CAS: 105742-76-5)?

Ganoderic acid C6 (CAS: 105742-76-5) is used primarily in the pharmaceutical and nutraceutical indus...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C6 (CAS: 105742-76-5)?

When handling Ganoderic acid C6 (CAS: 105742-76-5), it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...