Compound Q&A

What industries use S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

Answer

S-(4-Chlorobenzyl) diethylcarbamothioate
S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) is used in the pharmaceutical industry for its antifungal properties. It is also utilized in the detection of sulfhydryl groups in biological systems, making it useful in sensor applications. Additionally, it may have potential applications in the semiconductor industry due to its chemical structure.

About

CAS No 28249-77-6
English Name S-(4-Chlorobenzyl) diethylcarbamothioate
Molecular Formula C12H16ClNOS
Molecular Weight 257.79 g/mol
SMILES CCN(CC)C(=O)SCc1ccc(cc1)Cl
InChIKey QHTQREMOGMZHJV-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) is a crystalline compound with a molecula...

Compound Q&A

How is S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) typically synthesized?

S-(4-Chlorobenzyl) diethylcarbamothioate is typically synthesized via the reaction of diethyl carbam...

Compound Q&A

What precautions should be taken when handling S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

When handling S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6), ensure proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...