Compound Q&A

What are the physical and chemical properties of S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

Answer

S-(4-Chlorobenzyl) diethylcarbamothioate
S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) is a crystalline compound with a molecular weight of approximately 246.12 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and methanol. The compound is reactive due to the presence of the carbamothioate group, which can undergo nucleophilic substitution reactions.

About

CAS No 28249-77-6
English Name S-(4-Chlorobenzyl) diethylcarbamothioate
Molecular Formula C12H16ClNOS
Molecular Weight 257.79 g/mol
SMILES CCN(CC)C(=O)SCc1ccc(cc1)Cl
InChIKey QHTQREMOGMZHJV-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) typically synthesized?

S-(4-Chlorobenzyl) diethylcarbamothioate is typically synthesized via the reaction of diethyl carbam...

Compound Q&A

What industries use S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

When handling S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6), ensure proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...