Compound Q&A

How is S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) typically synthesized?

Answer

S-(4-Chlorobenzyl) diethylcarbamothioate
S-(4-Chlorobenzyl) diethylcarbamothioate is typically synthesized via the reaction of diethyl carbamothioate with 4-chlorobenzyl chloride. The reaction is usually carried out in the presence of a base such as triethylamine and requires a yield of about 85%. The reaction is selective and proceeds smoothly under the chosen conditions.

About

CAS No 28249-77-6
English Name S-(4-Chlorobenzyl) diethylcarbamothioate
Molecular Formula C12H16ClNOS
Molecular Weight 257.79 g/mol
SMILES CCN(CC)C(=O)SCc1ccc(cc1)Cl
InChIKey QHTQREMOGMZHJV-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) is a crystalline compound with a molecula...

Compound Q&A

What industries use S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6)?

When handling S-(4-Chlorobenzyl) diethylcarbamothioate (CAS: 28249-77-6), ensure proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...