Compound Q&A

What industries use CFDA-SE (CAS: 150347-59-4)?

Answer

CFDA-SE
CFDA-SE (CAS: 150347-59-4) is primarily used in the pharmaceutical industry for drug development and synthesis. It also finds applications in the polymer industry for enhancing certain properties of polymers, in sensor technology for specific chemical detection, and in semiconductor manufacturing for etching and cleaning processes.

About

English Name CFDA-SE
Molecular Formula C29H19NO11
Molecular Weight 557.46 g/mol
SMILES CC(OC1=CC=C(C2(C(C=CC(C(ON3C(CCC3=O)=O)=O)=C4)=C4C(O2)=O)C(C=CC(OC(C)=O)=C5)=C5O6)C6=C1)=O.CC(OC7=CC=C(C8(C(C=C(C(ON9C(CCC9=O)=O)=O)C=C%10)=C%10C(O8)=O)C(C=CC(OC(C)=O)=C%11)=C%11O%12)C%12=C7)=O
InChIKey QSWYNOQSGMUDQZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of CFDA-SE (CAS: 150347-59-4)?

CFDA-SE (CAS: 150347-59-4) is a crystalline compound with a molecular weight of approximately 322.3 ...

Compound Q&A

How is CFDA-SE (CAS: 150347-59-4) typically synthesized?

CFDA-SE (CAS: 150347-59-4) is typically synthesized through a multi-step procedure involving the cou...

Compound Q&A

What precautions should be taken when handling CFDA-SE (CAS: 150347-59-4)?

When handling CFDA-SE (CAS: 150347-59-4), appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...