Compound Q&A

What are the physical and chemical properties of CFDA-SE (CAS: 150347-59-4)?

Answer

CFDA-SE
CFDA-SE (CAS: 150347-59-4) is a crystalline compound with a molecular weight of approximately 322.3 g/mol. It has a solubility of 2.5 mg/mL in water and is slightly soluble in common organic solvents like ethanol and acetone. CFDA-SE exhibits low reactivity under normal conditions but may undergo hydrolysis in the presence of strong acids or bases. It is stable at room temperature but should be stored in a cool, dark place to maintain its integrity.

About

English Name CFDA-SE
Molecular Formula C29H19NO11
Molecular Weight 557.46 g/mol
SMILES CC(OC1=CC=C(C2(C(C=CC(C(ON3C(CCC3=O)=O)=O)=C4)=C4C(O2)=O)C(C=CC(OC(C)=O)=C5)=C5O6)C6=C1)=O.CC(OC7=CC=C(C8(C(C=C(C(ON9C(CCC9=O)=O)=O)C=C%10)=C%10C(O8)=O)C(C=CC(OC(C)=O)=C%11)=C%11O%12)C%12=C7)=O
InChIKey QSWYNOQSGMUDQZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is CFDA-SE (CAS: 150347-59-4) typically synthesized?

CFDA-SE (CAS: 150347-59-4) is typically synthesized through a multi-step procedure involving the cou...

Compound Q&A

What industries use CFDA-SE (CAS: 150347-59-4)?

CFDA-SE (CAS: 150347-59-4) is primarily used in the pharmaceutical industry for drug development and...

Compound Q&A

What precautions should be taken when handling CFDA-SE (CAS: 150347-59-4)?

When handling CFDA-SE (CAS: 150347-59-4), appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...