Compound Q&A

What industries use O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

Answer

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine
O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) is primarily used in the pharmaceutical industry for the synthesis of other compounds. It also finds applications in the polymer industry for the modification of polymer properties. Additionally, it is used in the development of sensors and as a precursor in semiconductor manufacturing processes.

About

CAS No 94832-15-2
English Name O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine
Molecular Formula C7H5F3N2O3
Molecular Weight 222.12 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)ON
InChIKey KIEHAOBEQSYFRF-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) is a white or off-white crystal...

Compound Q&A

How is O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) typically synthesized?

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine is typically synthesized by the trifluoromethylat...

Compound Q&A

What precautions should be taken when handling O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

When handling O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...