Compound Q&A

What are the physical and chemical properties of O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

Answer

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine
O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) is a white or off-white crystalline solid. It has a molecular weight of approximately 326.15 g/mol and is slightly soluble in water. The compound is highly reactive due to the presence of the nitro and trifluoromethyl groups. It shows good stability under normal conditions but can react with reducing agents or strong bases.

About

CAS No 94832-15-2
English Name O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine
Molecular Formula C7H5F3N2O3
Molecular Weight 222.12 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)ON
InChIKey KIEHAOBEQSYFRF-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) typically synthesized?

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine is typically synthesized by the trifluoromethylat...

Compound Q&A

What industries use O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

When handling O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...