Compound Q&A

How is O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) typically synthesized?

Answer

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine
O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine is typically synthesized by the trifluoromethylation of 4-nitrobenzaldehyde followed by hydroxylation. The reaction involves the use of trifluoromethylation reagents and an appropriate catalyst to achieve high yield and selectivity. The hydroxylation step is carried out under controlled conditions to ensure the formation of the desired product.

About

CAS No 94832-15-2
English Name O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine
Molecular Formula C7H5F3N2O3
Molecular Weight 222.12 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)ON
InChIKey KIEHAOBEQSYFRF-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) is a white or off-white crystal...

Compound Q&A

What industries use O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2)?

When handling O-[4-nitro-2-(trifluoromethyl)phenyl]hydroxylamine (CAS: 94832-15-2), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...