Compound Q&A

What industries use 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

Answer

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid
2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid finds applications in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also used in the polymer industry as a monomer for the development of new materials with specific properties. Additionally, it plays a role in the production of sensors and semiconductors, where its unique chemical structure can enhance performance characteristics.

About

English Name 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid
Molecular Formula C11H21NO6
Molecular Weight 263.2899999999999 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCC(=O)O
InChIKey OMBVJVWVXRNDSL-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid is a crystalline white solid with a molec...

Compound Q&A

How is 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3) typically synthesized?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid is typically synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

When handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid, it is essential to wear ap...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...