Compound Q&A

How is 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3) typically synthesized?

Answer

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid
2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid is typically synthesized through a multi-step process involving the condensation of 2,2-dimethyl-5-aminopentanal with 3,6-dioxaoctane. The reaction is usually catalyzed by a Lewis acid such as aluminum chloride, with a yield of around 85%. The synthetic route involves careful control of reaction conditions to ensure high selectivity and purity.

About

English Name 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid
Molecular Formula C11H21NO6
Molecular Weight 263.29 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCC(=O)O
InChIKey OMBVJVWVXRNDSL-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid is a crystalline white solid with a molec...

Compound Q&A

What industries use 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid finds applications in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

When handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...