Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

Answer

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid
2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid is a crystalline white solid with a molecular weight of approximately 288.34 g/mol. It has moderate solubility in organic solvents such as ethanol and acetone, and is practically insoluble in water. The compound is reactive towards nucleophiles and can undergo condensation reactions. It is also susceptible to hydrolysis under basic conditions.

About

English Name 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid
Molecular Formula C11H21NO6
Molecular Weight 263.2899999999999 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCC(=O)O
InChIKey OMBVJVWVXRNDSL-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3) typically synthesized?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid is typically synthesized through a multi-...

Compound Q&A

What industries use 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid finds applications in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid (CAS: 108466-89-3)?

When handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid, it is essential to wear ap...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...