Compound Q&A

What are the physical and chemical properties of (3R)-3-Amino-3-phenylpropanoic acid hydrochloride (CAS: 83649-48-3)?

Answer

(3R)-3-Amino-3-phenylpropanoic acid hydrochloride (1:1)
(3R)-3-Amino-3-phenylpropanoic acid hydrochloride is a crystalline solid with a molecular weight of approximately 220.31 g/mol. It has a solubility of about 40 mg/mL in water. The compound is mildly reactive, particularly in acidic and basic conditions, making it susceptible to hydrolysis and racemization. It is a key intermediate in the synthesis of various pharmaceuticals and agrochemicals.

About

CAS No 83649-48-3
English Name (3R)-3-Amino-3-phenylpropanoic acid hydrochloride (1:1)
Molecular Formula C9H12ClNO2
Molecular Weight 201.65 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)N.Cl
InChIKey ABEBCTCOPRULFS-DDWIOCJRSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is (3R)-3-Amino-3-phenylpropanoic acid hydrochloride (CAS: 83649-48-3) typically synthesized?

(3R)-3-Amino-3-phenylpropanoic acid hydrochloride is typically synthesized through the coupling of a...

Compound Q&A

What industries use (3R)-3-Amino-3-phenylpropanoic acid hydrochloride (CAS: 83649-48-3)?

(3R)-3-Amino-3-phenylpropanoic acid hydrochloride finds application in the pharmaceutical industry a...

Compound Q&A

What precautions should be taken when handling (3R)-3-Amino-3-phenylpropanoic acid hydrochloride (CAS: 83649-48-3)?

When handling (3R)-3-Amino-3-phenylpropanoic acid hydrochloride, it is important to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...