Compound Q&A

How should (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0) be stored?

Answer

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride (1:1)
(2S)-2-Amino-4-phenylbutanoic acid hydrochloride should be stored in a cool, dry place, protected from direct sunlight and heat sources to maintain its stability. Store it in a sealed container to prevent moisture absorption. The product should be kept out of reach of children and stored away from incompatible materials to ensure safety during handling and transportation.

About

English Name (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)N.Cl
InChIKey CHBMONIBOQCTCF-FVGYRXGTSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What is (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0)?

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride, also known as 2-(4-Phenylbutan-2-yl)glycine hydroc...

Compound Q&A

What are the main uses of (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0)?

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride is primarily used in pharmaceuticals as an intermed...

Compound Q&A

Is (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0) safe?

Yes, (2S)-2-Amino-4-phenylbutanoic acid hydrochloride is generally considered safe when handled prop...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...