Compound Q&A

What is (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0)?

Answer

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride (1:1)
(2S)-2-Amino-4-phenylbutanoic acid hydrochloride, also known as 2-(4-Phenylbutan-2-yl)glycine hydrochloride, is a white to off-white crystalline solid. It is an organic compound with the molecular formula C11H16N2O3·HCl. This compound is characterized by its amine and phenyl functionalities, making it useful in various applications such as pharmaceuticals, research, and industrial processes.

About

English Name (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)N.Cl
InChIKey CHBMONIBOQCTCF-FVGYRXGTSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0)?

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride is primarily used in pharmaceuticals as an intermed...

Compound Q&A

Is (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0) safe?

Yes, (2S)-2-Amino-4-phenylbutanoic acid hydrochloride is generally considered safe when handled prop...

Compound Q&A

How should (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0) be stored?

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride should be stored in a cool, dry place, protected fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...