Compound Q&A

What are the main uses of (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0)?

Answer

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride (1:1)
(2S)-2-Amino-4-phenylbutanoic acid hydrochloride is primarily used in pharmaceuticals as an intermediate in the synthesis of other drugs. It is also utilized in research for its biological activity and in the food industry for its potential health benefits and flavor enhancers. Additionally, it has applications in industrial chemistry for various reactions and processes.

About

English Name (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (1:1)
Molecular Formula C10H14ClNO2
Molecular Weight 215.68 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)N.Cl
InChIKey CHBMONIBOQCTCF-FVGYRXGTSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What is (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0)?

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride, also known as 2-(4-Phenylbutan-2-yl)glycine hydroc...

Compound Q&A

Is (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0) safe?

Yes, (2S)-2-Amino-4-phenylbutanoic acid hydrochloride is generally considered safe when handled prop...

Compound Q&A

How should (2S)-2-Amino-4-phenylbutanoic acid hydrochloride (CAS: 105382-09-0) be stored?

(2S)-2-Amino-4-phenylbutanoic acid hydrochloride should be stored in a cool, dry place, protected fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...