Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine
When handling this compound, appropriate personal protective equipment (PPE) should be used, including gloves, lab coat, and safety goggles. Handling should be conducted in a well-ventilated area or fume hood. Spills should be handled using appropriate absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine
Molecular Formula C40H33N3O4
Molecular Weight 619.72 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)CC(C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57
InChIKey XXMYDXUIZKNHDT-DIPNUNPCSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 857.6 g/mol....

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1) typically synthesized?

This compound is synthesized using fluorenylmethoxycarbonyl (Fmoc) chemistry. The Fmoc-protected his...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of peptide drugs. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...