Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1) typically synthesized?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine
This compound is synthesized using fluorenylmethoxycarbonyl (Fmoc) chemistry. The Fmoc-protected histidine is coupled to a trityl-protected amino acid or peptide via standard peptide coupling reactions. Typical conditions involve the use of HATU or DCC as coupling agents, and diisopropylethylamine as a base. The product is purified by flash chromatography or reversed-phase HPLC.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine
Molecular Formula C40H33N3O4
Molecular Weight 619.72 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)CC(C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57
InChIKey XXMYDXUIZKNHDT-DIPNUNPCSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 857.6 g/mol....

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of peptide drugs. I...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

When handling this compound, appropriate personal protective equipment (PPE) should be used, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...