Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine
This compound is a solid with a crystalline form. Its molecular weight is approximately 857.6 g/mol. It has a low solubility in water but is more soluble in organic solvents such as DMSO and DMF. Chemically, it is highly reactive, particularly towards nucleophiles, and is often used in peptide synthesis due to its stability and ease of protection.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine
Molecular Formula C40H33N3O4
Molecular Weight 619.72 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)CC(C(=O)O)NC(=O)OCC5C6=CC=CC=C6C7=CC=CC=C57
InChIKey XXMYDXUIZKNHDT-DIPNUNPCSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1) typically synthesized?

This compound is synthesized using fluorenylmethoxycarbonyl (Fmoc) chemistry. The Fmoc-protected his...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of peptide drugs. I...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine (CAS: 135610-90-1)?

When handling this compound, appropriate personal protective equipment (PPE) should be used, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...