Compound Q&A

What industries use 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5)?

Answer

2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is widely used in the pharmaceutical industry for the synthesis of various biologically active compounds. It is also utilized in the polymer industry for the production of functional polymers, and in the semiconductor industry for the preparation of advanced materials. Additionally, it has applications in sensor technology for detecting specific chemical species.

About

CAS No 87100-28-5
English Name 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Molecular Formula C13H19BO2
Molecular Weight 218.11 g/mol
SMILES CC1(C)OB(Cc2ccccc2)OC1(C)C
InChIKey YCNQPAVKQPLZRS-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5)?

2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a colorless, crystalline compound with a molecul...

Compound Q&A

How is 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5) typically synthesized?

2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is commonly synthesized via the reaction of 2-benzy...

Compound Q&A

What precautions should be taken when handling 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5)?

When handling 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, it is essential to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...