Compound Q&A

How is 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5) typically synthesized?

Answer

2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is commonly synthesized via the reaction of 2-benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl triflate with sodium borohydride. The reaction typically requires a strong base like sodium hydride or lithium hexamethyldisilazide as a catalyst. The yield is generally around 70-80%, and the product is isolated by column chromatography.

About

CAS No 87100-28-5
English Name 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Molecular Formula C13H19BO2
Molecular Weight 218.11 g/mol
SMILES CC1(C)OB(Cc2ccccc2)OC1(C)C
InChIKey YCNQPAVKQPLZRS-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5)?

2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a colorless, crystalline compound with a molecul...

Compound Q&A

What industries use 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5)?

2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is widely used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS: 87100-28-5)?

When handling 2-Benzyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, it is essential to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...