Compound Q&A

What industries use 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1)?

Answer

8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one
8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one is primarily used in the pharmaceutical industry for the development of new drugs. It also has potential applications in the production of polymers, sensors, and semiconductors due to its unique chemical structure and reactivity.

About

CAS No 50892-62-1
English Name 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one
Molecular Formula C13H9ClN2O
Molecular Weight 244.68 g/mol
SMILES C1=CC=C2C(=C1)C(=O)NC3=C(N2)C=CC(=C3)Cl
InChIKey YVWNDABPZGGQFE-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1)?

8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one is a white to off-white solid with a mole...

Compound Q&A

How is 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1) typically synthesized?

8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one can be synthesized through a multi-step p...

Compound Q&A

What precautions should be taken when handling 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1)?

When handling 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...