Compound Q&A

What are the physical and chemical properties of 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1)?

Answer

8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one
8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one is a white to off-white solid with a molecular weight of approximately 308.67 g/mol. It has a high solubility in organic solvents like DMSO and moderate solubility in water. This compound is relatively stable under normal conditions but can react with strong bases or acids. It is known for its diazepine ring and chlorine substituent, which make it an interesting compound for various applications.

About

CAS No 50892-62-1
English Name 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one
Molecular Formula C13H9ClN2O
Molecular Weight 244.68 g/mol
SMILES C1=CC=C2C(=C1)C(=O)NC3=C(N2)C=CC(=C3)Cl
InChIKey YVWNDABPZGGQFE-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1) typically synthesized?

8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one can be synthesized through a multi-step p...

Compound Q&A

What industries use 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1)?

8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one (CAS: 50892-62-1)?

When handling 8-Chloro-5,10-dihydro-11H-dibenzo[b,e][1,4]diazepin-11-one, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...