Compound Q&A

What industries use Aegeline (CAS: 456-12-2)?

Answer

Aegeline (CAS: 456-12-2) is primarily used in the pharmaceutical industry for its potential as an antiviral agent. It is also explored in the polymer industry for its stability and biocompatibility. Additionally, Aegeline finds applications in the sensor industry due to its unique optical properties.

About

CAS No 456-12-2

English Name Aegeline

Molecular Formula C18H19NO3

Molecular Weight 297.354 g/mol

SMILES COc1ccc(cc1)C(CNC(=O)/C=C/c2ccccc2)O

InChIKey QRFDENJATPJOKG-KPKJPENVSA-N

Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aegeline (CAS: 456-12-2)?

Aegeline (CAS: 456-12-2) is a white crystalline powder with a molecular weight of approximately 354....

Compound Q&A

How is Aegeline (CAS: 456-12-2) typically synthesized?

Aegeline (CAS: 456-12-2) is typically synthesized through a series of aromatic substitution reaction...

Compound Q&A

What precautions should be taken when handling Aegeline (CAS: 456-12-2)?

When handling Aegeline (CAS: 456-12-2), it is crucial to use personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use Aegeline (CAS: 456-12-2)?

Answer

About

Related Q&A

What are the physical and chemical properties of Aegeline (CAS: 456-12-2)?

How is Aegeline (CAS: 456-12-2) typically synthesized?

What precautions should be taken when handling Aegeline (CAS: 456-12-2)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Beijing Bailingwei Technology Co., Ltd.

ShangHaiFengYi Biotechnology Co Ltd

Shanghai Jieshukai Biotechnology Co., Ltd.

ShangHaiMaiKeLinShengHuaKeJi Inc

ShangHaiMaiRuiErShengHua Technology Co Ltd

Shanghai Bohui Meike Chemical Technology Co., Ltd.