Compound Q&A

What are the physical and chemical properties of Aegeline (CAS: 456-12-2)?

Answer

Aegeline
Aegeline (CAS: 456-12-2) is a white crystalline powder with a molecular weight of approximately 354.32 g/mol. It is sparingly soluble in water and ethanol. Aegeline is relatively stable under normal conditions but reacts with strong oxidizing agents. It can be synthesized using various methods, often involving aromatic substitution reactions.

About

CAS No 456-12-2
English Name Aegeline
Molecular Formula C18H19NO3
Molecular Weight 297.354 g/mol
SMILES COc1ccc(cc1)C(CNC(=O)/C=C/c2ccccc2)O
InChIKey QRFDENJATPJOKG-KPKJPENVSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is Aegeline (CAS: 456-12-2) typically synthesized?

Aegeline (CAS: 456-12-2) is typically synthesized through a series of aromatic substitution reaction...

Compound Q&A

What industries use Aegeline (CAS: 456-12-2)?

Aegeline (CAS: 456-12-2) is primarily used in the pharmaceutical industry for its potential as an an...

Compound Q&A

What precautions should be taken when handling Aegeline (CAS: 456-12-2)?

When handling Aegeline (CAS: 456-12-2), it is crucial to use personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...