Compound Q&A

How is Aegeline (CAS: 456-12-2) typically synthesized?

Answer

Aegeline
Aegeline (CAS: 456-12-2) is typically synthesized through a series of aromatic substitution reactions, such as Friedel-Crafts acylation followed by reduction. The synthesis involves the use of a catalyst like aluminum chloride and requires precise conditions to achieve high yield and selectivity.

About

CAS No 456-12-2
English Name Aegeline
Molecular Formula C18H19NO3
Molecular Weight 297.354 g/mol
SMILES COc1ccc(cc1)C(CNC(=O)/C=C/c2ccccc2)O
InChIKey QRFDENJATPJOKG-KPKJPENVSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aegeline (CAS: 456-12-2)?

Aegeline (CAS: 456-12-2) is a white crystalline powder with a molecular weight of approximately 354....

Compound Q&A

What industries use Aegeline (CAS: 456-12-2)?

Aegeline (CAS: 456-12-2) is primarily used in the pharmaceutical industry for its potential as an an...

Compound Q&A

What precautions should be taken when handling Aegeline (CAS: 456-12-2)?

When handling Aegeline (CAS: 456-12-2), it is crucial to use personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...