Compound Q&A

How is Aegeline (CAS: 456-12-2) typically synthesized?

Answer

Aegeline
Aegeline (CAS: 456-12-2) is typically synthesized through a series of aromatic substitution reactions, such as Friedel-Crafts acylation followed by reduction. The synthesis involves the use of a catalyst like aluminum chloride and requires precise conditions to achieve high yield and selectivity.

About

CAS No 456-12-2
English Name Aegeline
Molecular Formula C18H19NO3
Molecular Weight 297.35 g/mol
SMILES COc1ccc(cc1)C(CNC(=O)/C=C/c2ccccc2)O
InChIKey QRFDENJATPJOKG-KPKJPENVSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Aegeline (CAS: 456-12-2)?

Aegeline (CAS: 456-12-2) is a white crystalline powder with a molecular weight of approximately 354....

Compound Q&A

What industries use Aegeline (CAS: 456-12-2)?

Aegeline (CAS: 456-12-2) is primarily used in the pharmaceutical industry for its potential as an an...

Compound Q&A

What precautions should be taken when handling Aegeline (CAS: 456-12-2)?

When handling Aegeline (CAS: 456-12-2), it is crucial to use personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...