Compound Q&A

What precautions should be taken when handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

Answer

1-fluoro-4-nitronaphthalene
When handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. The compound should be stored in a fume hood to minimize exposure to fumes. In case of a spill, it is recommended to clean up using appropriate absorbents and dispose of the waste according to local regulations. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 341-92-4
English Name 1-fluoro-4-nitronaphthalene
Molecular Formula C10H6FNO2
Molecular Weight 191.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2F)[N+](=O)[O-]
InChIKey XVDSBUCGMJBTNO-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 1-fluoro-4-nitronaphthalene (CAS: 341-92-4) typically synthesized?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is typically synthesized by the nitration of 1-fluoronap...

Compound Q&A

What industries use 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is used in various industries, particularly in the pharm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...