Compound Q&A

What are the physical and chemical properties of 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

Answer

1-fluoro-4-nitronaphthalene
1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is a crystalline solid with a molecular weight of approximately 215.06 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable under normal conditions but can react with reducing agents. It is an important intermediate in the synthesis of various organic compounds and pharmaceuticals.

About

CAS No 341-92-4
English Name 1-fluoro-4-nitronaphthalene
Molecular Formula C10H6FNO2
Molecular Weight 191.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2F)[N+](=O)[O-]
InChIKey XVDSBUCGMJBTNO-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 1-fluoro-4-nitronaphthalene (CAS: 341-92-4) typically synthesized?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is typically synthesized by the nitration of 1-fluoronap...

Compound Q&A

What industries use 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is used in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

When handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4), it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...