Compound Q&A

What are the physical and chemical properties of 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

Answer

1-fluoro-4-nitronaphthalene
1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is a crystalline solid with a molecular weight of approximately 215.06 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable under normal conditions but can react with reducing agents. It is an important intermediate in the synthesis of various organic compounds and pharmaceuticals.

About

CAS No 341-92-4
English Name 1-fluoro-4-nitronaphthalene
Molecular Formula C10H6FNO2
Molecular Weight 191.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2F)[N+](=O)[O-]
InChIKey XVDSBUCGMJBTNO-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 1-fluoro-4-nitronaphthalene (CAS: 341-92-4) typically synthesized?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is typically synthesized by the nitration of 1-fluoronap...

Compound Q&A

What industries use 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is used in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

When handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4), it is essential to use appropriate person...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...