Compound Q&A

What industries use 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

Answer

1-fluoro-4-nitronaphthalene
1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is used in various industries, particularly in the pharmaceutical sector for the synthesis of medicinally active compounds. It is also utilized in the production of organic semiconductors and as a precursor in the development of sensor materials and polymer-based applications.

About

CAS No 341-92-4
English Name 1-fluoro-4-nitronaphthalene
Molecular Formula C10H6FNO2
Molecular Weight 191.16 g/mol
SMILES C1=CC=C2C(=C1)C(=CC=C2F)[N+](=O)[O-]
InChIKey XVDSBUCGMJBTNO-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 1-fluoro-4-nitronaphthalene (CAS: 341-92-4) typically synthesized?

1-Fluoro-4-nitronaphthalene (CAS: 341-92-4) is typically synthesized by the nitration of 1-fluoronap...

Compound Q&A

What precautions should be taken when handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4)?

When handling 1-fluoro-4-nitronaphthalene (CAS: 341-92-4), it is essential to use appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...