Compound Q&A

What industries use 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

Answer

2,3-Thioepoxy Madol
2,3-Thioepoxy Madol (CAS: 4267-80-5) is used in various industries, including pharmaceuticals for the synthesis of biologically active molecules, and in the production of polymers for their unique chemical properties. It also finds application in the development of sensors and semiconductors due to its electronic and optical properties.

About

CAS No 4267-80-5
English Name 2,3-Thioepoxy Madol
Molecular Formula C20H32OS
Molecular Weight 320.5 g/mol
SMILES CC12CCC3C(C1CCC2(C)O)CCC4C3(CC5C(C4)S5)C
InChIKey UPLPHRJJTCUQAY-WIRWPRASSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

2,3-Thioepoxy Madol (CAS: 4267-80-5) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 2,3-Thioepoxy Madol (CAS: 4267-80-5) typically synthesized?

2,3-Thioepoxy Madol is typically synthesized through the epoxidation of a thioether compound using p...

Compound Q&A

What precautions should be taken when handling 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

When handling 2,3-Thioepoxy Madol (CAS: 4267-80-5), it is recommended to wear appropriate personal p...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...