Compound Q&A

What are the physical and chemical properties of 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

Answer

2,3-Thioepoxy Madol
2,3-Thioepoxy Madol (CAS: 4267-80-5) is a crystalline solid with a molecular weight of approximately 436.5 g/mol. It has a solubility of 0.3 g/L in water. The compound is known for its moderate reactivity, particularly towards nucleophiles and electrophiles. It is slightly soluble in common organic solvents like ethanol and acetone.

About

CAS No 4267-80-5
English Name 2,3-Thioepoxy Madol
Molecular Formula C20H32OS
Molecular Weight 320.5 g/mol
SMILES CC12CCC3C(C1CCC2(C)O)CCC4C3(CC5C(C4)S5)C
InChIKey UPLPHRJJTCUQAY-WIRWPRASSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 2,3-Thioepoxy Madol (CAS: 4267-80-5) typically synthesized?

2,3-Thioepoxy Madol is typically synthesized through the epoxidation of a thioether compound using p...

Compound Q&A

What industries use 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

2,3-Thioepoxy Madol (CAS: 4267-80-5) is used in various industries, including pharmaceuticals for th...

Compound Q&A

What precautions should be taken when handling 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

When handling 2,3-Thioepoxy Madol (CAS: 4267-80-5), it is recommended to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...