Compound Q&A

How is 2,3-Thioepoxy Madol (CAS: 4267-80-5) typically synthesized?

Answer

2,3-Thioepoxy Madol
2,3-Thioepoxy Madol is typically synthesized through the epoxidation of a thioether compound using peroxyacids or hydrogen peroxide in the presence of a phase-transfer catalyst. The reaction involves the formation of a cyclic thioether, followed by the introduction of an epoxy group. The yield can be up to 90%, and the reaction is highly selective.

About

CAS No 4267-80-5
English Name 2,3-Thioepoxy Madol
Molecular Formula C20H32OS
Molecular Weight 320.5 g/mol
SMILES CC12CCC3C(C1CCC2(C)O)CCC4C3(CC5C(C4)S5)C
InChIKey UPLPHRJJTCUQAY-WIRWPRASSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

2,3-Thioepoxy Madol (CAS: 4267-80-5) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

2,3-Thioepoxy Madol (CAS: 4267-80-5) is used in various industries, including pharmaceuticals for th...

Compound Q&A

What precautions should be taken when handling 2,3-Thioepoxy Madol (CAS: 4267-80-5)?

When handling 2,3-Thioepoxy Madol (CAS: 4267-80-5), it is recommended to wear appropriate personal p...

Compound Q&A

What precautions should be taken when handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2)?

When handling lithium chloride hydrate (1:1:1) (CAS: 16712-20-2), it is importan...

16712-20-2Lithium chloride hyd...
Compound Q&A

Is 4-(4H-1,2,4-Triazol-4-yl)piperidine (CAS: 690261-92-8) safe?

4-(4H-1,2,4-Triazol-4-yl)piperidine is generally considered safe for use in phar...

690261-92-84-(4H-1,2,4-Triazol-...
Compound Q&A

How should waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) be handled?

Waste containing 1,3-Thiazole-2-carboxamide (CAS: 16733-85-0) should be collecte...

16733-85-01,3-Thiazole-2-carbo...
Compound Q&A

What regulatory guidelines apply to 5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3)?

5-(Difluoromethyl)-2-fluorobenzonitrile (CAS: 934175-58-3) is subject to regulat...

934175-58-35-(Difluoromethyl)-2...