Compound Q&A

What precautions should be taken when handling Angeloylgomisin H (CAS: 66056-22-2)?

Answer

Angeloylgomisin H
When handling Angeloylgomisin H, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up using appropriate solvent-free absorbents. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 66056-22-2
English Name Angeloylgomisin H
Molecular Formula C28H36O8
Molecular Weight 500.58 g/mol
SMILES CC=C(C)C(=O)OC1=C2C(=CC(=C1OC)OC)CC(C(CC3=CC(=C(C(=C32)OC)OC)OC)(C)O)C
InChIKey ZSAUXCVJDYCLRS-XNTDXEJSSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Angeloylgomisin H (CAS: 66056-22-2)?

Angeloylgomisin H is a crystalline compound with a molecular weight of approximately 694.74 g/mol. I...

Compound Q&A

How is Angeloylgomisin H (CAS: 66056-22-2) typically synthesized?

Angeloylgomisin H is typically synthesized through a multi-step process involving the condensation o...

Compound Q&A

What industries use Angeloylgomisin H (CAS: 66056-22-2)?

Angeloylgomisin H is primarily used in the pharmaceutical industry for its potential anti-inflammato...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...