Compound Q&A

How is Angeloylgomisin H (CAS: 66056-22-2) typically synthesized?

Answer

Angeloylgomisin H
Angeloylgomisin H is typically synthesized through a multi-step process involving the condensation of gomisin A with angeloyl chloride, followed by further transformations. The synthesis involves the use of catalysts such as acid or base catalysts and often requires high selectivity to achieve the desired product. The overall yield is around 50-60%, depending on the purification and reaction conditions.

About

CAS No 66056-22-2
English Name Angeloylgomisin H
Molecular Formula C28H36O8
Molecular Weight 500.58 g/mol
SMILES CC=C(C)C(=O)OC1=C2C(=CC(=C1OC)OC)CC(C(CC3=CC(=C(C(=C32)OC)OC)OC)(C)O)C
InChIKey ZSAUXCVJDYCLRS-XNTDXEJSSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Angeloylgomisin H (CAS: 66056-22-2)?

Angeloylgomisin H is a crystalline compound with a molecular weight of approximately 694.74 g/mol. I...

Compound Q&A

What industries use Angeloylgomisin H (CAS: 66056-22-2)?

Angeloylgomisin H is primarily used in the pharmaceutical industry for its potential anti-inflammato...

Compound Q&A

What precautions should be taken when handling Angeloylgomisin H (CAS: 66056-22-2)?

When handling Angeloylgomisin H, it is essential to use personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...