Compound Q&A

What are the physical and chemical properties of Angeloylgomisin H (CAS: 66056-22-2)?

Answer

Angeloylgomisin H
Angeloylgomisin H is a crystalline compound with a molecular weight of approximately 694.74 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and ethanol. Chemically, it is relatively stable but can react with strong acids or bases. It is also susceptible to hydrolysis under basic conditions.

About

CAS No 66056-22-2
English Name Angeloylgomisin H
Molecular Formula C28H36O8
Molecular Weight 500.58 g/mol
SMILES CC=C(C)C(=O)OC1=C2C(=CC(=C1OC)OC)CC(C(CC3=CC(=C(C(=C32)OC)OC)OC)(C)O)C
InChIKey ZSAUXCVJDYCLRS-XNTDXEJSSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is Angeloylgomisin H (CAS: 66056-22-2) typically synthesized?

Angeloylgomisin H is typically synthesized through a multi-step process involving the condensation o...

Compound Q&A

What industries use Angeloylgomisin H (CAS: 66056-22-2)?

Angeloylgomisin H is primarily used in the pharmaceutical industry for its potential anti-inflammato...

Compound Q&A

What precautions should be taken when handling Angeloylgomisin H (CAS: 66056-22-2)?

When handling Angeloylgomisin H, it is essential to use personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...