Compound Q&A

What industries use 2-Chloro-3-nitro-4-pyridinamine (CAS: 2789-25-5)?

Answer

2-Chloro-3-nitro-4-pyridinamine
2-Chloro-3-nitro-4-pyridinamine is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It also finds applications in the polymer industry for the production of special polymers with specific properties. Additionally, it is used in the semiconductor industry for the fabrication of electronic components.

About

CAS No 2789-25-5
English Name 2-Chloro-3-nitro-4-pyridinamine
Molecular Formula C5H4ClN3O2
Molecular Weight 173.56 g/mol
SMILES C1=CN=C(C(=C1N)[N+](=O)[O-])Cl
InChIKey PDQAWJXOYURKPI-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-3-nitro-4-pyridinamine (CAS: 2789-25-5)?

2-Chloro-3-nitro-4-pyridinamine is a crystalline solid with a molecular weight of approximately 207....

Compound Q&A

How is 2-Chloro-3-nitro-4-pyridinamine (CAS: 2789-25-5) typically synthesized?

2-Chloro-3-nitro-4-pyridinamine is commonly synthesized via the nitration of 2-chloro-4-pyridinamine...

Compound Q&A

What precautions should be taken when handling 2-Chloro-3-nitro-4-pyridinamine (CAS: 2789-25-5)?

When handling 2-Chloro-3-nitro-4-pyridinamine, appropriate personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...