Compound Q&A

What industries use 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

Answer

2-(Benzylsulfanyl)nicotinic acid
2-(Benzylsulfanyl)nicotinic acid is primarily used in the pharmaceutical industry for the synthesis of therapeutic agents. It also finds applications in the production of certain chemical sensors and in the development of materials for semiconductors. Its chemical properties make it suitable for various industrial processes requiring specific reactivity and stability characteristics.

About

English Name 2-(Benzylsulfanyl)nicotinic acid
Molecular Formula C13H11NO2S
Molecular Weight 245.3 g/mol
SMILES C1=CC=C(C=C1)CSC2=C(C=CC=N2)C(=O)O
InChIKey OJNZDGDYAXCHPB-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

2-(Benzylsulfanyl)nicotinic acid is a white to off-white crystalline powder with a molecular weight ...

Compound Q&A

How is 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2) typically synthesized?

2-(Benzylsulfanyl)nicotinic acid is typically synthesized via the reaction of nicotinoyl chloride wi...

Compound Q&A

What precautions should be taken when handling 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

When handling 2-(Benzylsulfanyl)nicotinic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...