Compound Q&A

How is 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2) typically synthesized?

Answer

2-(Benzylsulfanyl)nicotinic acid
2-(Benzylsulfanyl)nicotinic acid is typically synthesized via the reaction of nicotinoyl chloride with benzyl mercaptan in the presence of a strong base like sodium hydride. The yield is around 80%, and the process involves careful control of temperature and reaction time to achieve high selectivity and purity.

About

English Name 2-(Benzylsulfanyl)nicotinic acid
Molecular Formula C13H11NO2S
Molecular Weight 245.3 g/mol
SMILES C1=CC=C(C=C1)CSC2=C(C=CC=N2)C(=O)O
InChIKey OJNZDGDYAXCHPB-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

2-(Benzylsulfanyl)nicotinic acid is a white to off-white crystalline powder with a molecular weight ...

Compound Q&A

What industries use 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

2-(Benzylsulfanyl)nicotinic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

When handling 2-(Benzylsulfanyl)nicotinic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...