Compound Q&A

What are the physical and chemical properties of 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

Answer

2-(Benzylsulfanyl)nicotinic acid
2-(Benzylsulfanyl)nicotinic acid is a white to off-white crystalline powder with a molecular weight of approximately 260.32 g/mol. It has a solubility of about 100 mg/mL in water and is slightly soluble in ethanol. The compound is relatively stable under normal conditions but can react with strong oxidizing agents. It is typically used in pharmaceutical applications due to its chemical stability and reactivity.

About

English Name 2-(Benzylsulfanyl)nicotinic acid
Molecular Formula C13H11NO2S
Molecular Weight 245.3 g/mol
SMILES C1=CC=C(C=C1)CSC2=C(C=CC=N2)C(=O)O
InChIKey OJNZDGDYAXCHPB-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2) typically synthesized?

2-(Benzylsulfanyl)nicotinic acid is typically synthesized via the reaction of nicotinoyl chloride wi...

Compound Q&A

What industries use 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

2-(Benzylsulfanyl)nicotinic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2-(Benzylsulfanyl)nicotinic acid (CAS: 112811-90-2)?

When handling 2-(Benzylsulfanyl)nicotinic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...