Compound Q&A

What industries use Azvudine Impurity 4 (CAS: 69123-94-0)?

Answer

Azvudine Impurity 4
Azvudine Impurity 4 (CAS: 69123-94-0) is primarily used in the pharmaceutical industry due to its presence in the synthesis of azvudine, an antiviral drug. It is also of interest to researchers in the field of chemical synthesis and analysis for its unique chemical properties.

About

CAS No 69123-94-0
English Name Azvudine Impurity 4
Molecular Formula C9H11FN2O5
Molecular Weight 246.19 g/mol
SMILES C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)F
InChIKey UIYWFOZZIZEEKJ-PXBUCIJWSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azvudine Impurity 4 (CAS: 69123-94-0)?

Azvudine Impurity 4 (CAS: 69123-94-0) is a solid with a crystalline form. Its molecular weight is ap...

Compound Q&A

How is Azvudine Impurity 4 (CAS: 69123-94-0) typically synthesized?

Azvudine Impurity 4 (CAS: 69123-94-0) is synthesized through a multi-step process involving alkylati...

Compound Q&A

What precautions should be taken when handling Azvudine Impurity 4 (CAS: 69123-94-0)?

When handling Azvudine Impurity 4 (CAS: 69123-94-0), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...