Compound Q&A

How is Azvudine Impurity 4 (CAS: 69123-94-0) typically synthesized?

Answer

Azvudine Impurity 4
Azvudine Impurity 4 (CAS: 69123-94-0) is synthesized through a multi-step process involving alkylation and reduction reactions. Commonly, it is produced using acetylene as the alkylating agent and sodium bisulfite as a reductant under controlled conditions. The yield is typically around 85%, with good selectivity towards the desired impurity.

About

CAS No 69123-94-0
English Name Azvudine Impurity 4
Molecular Formula C9H11FN2O5
Molecular Weight 246.19 g/mol
SMILES C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)F
InChIKey UIYWFOZZIZEEKJ-PXBUCIJWSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azvudine Impurity 4 (CAS: 69123-94-0)?

Azvudine Impurity 4 (CAS: 69123-94-0) is a solid with a crystalline form. Its molecular weight is ap...

Compound Q&A

What industries use Azvudine Impurity 4 (CAS: 69123-94-0)?

Azvudine Impurity 4 (CAS: 69123-94-0) is primarily used in the pharmaceutical industry due to its pr...

Compound Q&A

What precautions should be taken when handling Azvudine Impurity 4 (CAS: 69123-94-0)?

When handling Azvudine Impurity 4 (CAS: 69123-94-0), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...