Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

Answer

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
When handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and laboratory coats. Handling should be done in a well-ventilated area or fume hood. In case of spill, immediate action should be taken according to the safety data sheet (SDS) guidelines, which include proper collection and disposal methods.

About

English Name 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
Molecular Formula C12H23NO6
Molecular Weight 277.32 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCCC(=O)O
InChIKey OZMXZVCAXAQCHJ-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid is a crystalline compound with a molecu...

Compound Q&A

How is 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9) typically synthesized?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid is typically synthesized via the ring-o...

Compound Q&A

What industries use 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid finds applications in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...