Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

Answer

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid is a crystalline compound with a molecular weight of approximately 310.37 g/mol. It has a low water solubility and is relatively stable in neutral and acidic conditions. The compound is known for its reactivity towards nucleophiles and can undergo esterification and amidation reactions.

About

English Name 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
Molecular Formula C12H23NO6
Molecular Weight 277.32 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCCC(=O)O
InChIKey OZMXZVCAXAQCHJ-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9) typically synthesized?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid is typically synthesized via the ring-o...

Compound Q&A

What industries use 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid finds applications in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

When handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...