Compound Q&A

What industries use 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

Answer

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid finds applications in the pharmaceutical industry for the development of novel drugs, in the polymer industry as a monomer, and in the sensor industry for its use in biosensing applications. It is also explored in semiconductor technology for its potential in organic electronics.

About

English Name 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid
Molecular Formula C12H23NO6
Molecular Weight 277.32 g/mol
SMILES CC(C)(C)OC(=O)NCCOCCOCCC(=O)O
InChIKey OZMXZVCAXAQCHJ-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid is a crystalline compound with a molecu...

Compound Q&A

How is 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9) typically synthesized?

2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid is typically synthesized via the ring-o...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid (CAS: 1365655-91-9)?

When handling 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...