Compound Q&A

What precautions should be taken when handling 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

Answer

4-Bromo-2,2-diphenylbutanoic acid
When handling 4-Bromo-2,2-diphenylbutanoic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a cool, well-ventilated area away from heat sources and incompatible materials. Ensure proper ventilation and use a fume hood during handling. In case of a spill, immediately clean up using appropriate absorbent materials and consult the Safety Data Sheet (SDS) for additional information.

About

CAS No 37742-98-6
English Name 4-Bromo-2,2-diphenylbutanoic acid
Molecular Formula C16H15BrO2
Molecular Weight 319.2 g/mol
SMILES C1=CC=C(C=C1)C(CCBr)(C2=CC=CC=C2)C(=O)O
InChIKey GFIYIIRFIODLLU-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

4-Bromo-2,2-diphenylbutanoic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6) typically synthesized?

4-Bromo-2,2-diphenylbutanoic acid is typically synthesized via the bromination of 2,2-diphenylbutano...

Compound Q&A

What industries use 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

4-Bromo-2,2-diphenylbutanoic acid is used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...