Compound Q&A

How is 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6) typically synthesized?

Answer

4-Bromo-2,2-diphenylbutanoic acid
4-Bromo-2,2-diphenylbutanoic acid is typically synthesized via the bromination of 2,2-diphenylbutanoic acid in the presence of a Lewis acid catalyst, such as aluminum bromide. The reaction involves the electrophilic bromination of the acid, followed by purification and crystallization steps to obtain the pure compound with high yield and selectivity.

About

CAS No 37742-98-6
English Name 4-Bromo-2,2-diphenylbutanoic acid
Molecular Formula C16H15BrO2
Molecular Weight 319.2 g/mol
SMILES C1=CC=C(C=C1)C(CCBr)(C2=CC=CC=C2)C(=O)O
InChIKey GFIYIIRFIODLLU-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

4-Bromo-2,2-diphenylbutanoic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

4-Bromo-2,2-diphenylbutanoic acid is used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

When handling 4-Bromo-2,2-diphenylbutanoic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...