Compound Q&A

What industries use 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

Answer

4-Bromo-2,2-diphenylbutanoic acid
4-Bromo-2,2-diphenylbutanoic acid is used in the pharmaceutical industry for the synthesis of certain APIs and in research for developing new drug candidates. It is also utilized in the polymer industry for modifying and functionalizing polymer chains. Additionally, it has applications in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 37742-98-6
English Name 4-Bromo-2,2-diphenylbutanoic acid
Molecular Formula C16H15BrO2
Molecular Weight 319.2 g/mol
SMILES C1=CC=C(C=C1)C(CCBr)(C2=CC=CC=C2)C(=O)O
InChIKey GFIYIIRFIODLLU-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

4-Bromo-2,2-diphenylbutanoic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6) typically synthesized?

4-Bromo-2,2-diphenylbutanoic acid is typically synthesized via the bromination of 2,2-diphenylbutano...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2,2-diphenylbutanoic acid (CAS: 37742-98-6)?

When handling 4-Bromo-2,2-diphenylbutanoic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...