Compound Q&A

What industries use N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1)?

Answer

N6-Benzoyl-2'-o-methyl-adenosine
N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1) is primarily used in the pharmaceutical industry for the development of nucleoside analogs and antiviral drugs. It is also used in the research of DNA and RNA modifications, which can have applications in biotechnology and genetic engineering. Additionally, it may be used in the synthesis of fluorescent probes for detection and imaging in analytical chemistry.

About

CAS No 85079-00-1
English Name N6-Benzoyl-2'-o-methyl-adenosine
Molecular Formula C18H19N5O5
Molecular Weight 385.38 g/mol
SMILES OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3NC(C4=CC=CC=C4)=O)O1)OC)O
InChIKey PHFHSPQCDRKMQJ-XWXWGSFUSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1)?

N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1) is a crystalline compound with a molecular weight...

Compound Q&A

How is N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1) typically synthesized?

N6-Benzoyl-2'-o-methyl-adenosine is typically synthesized by the benzoylation of 2'-o-methyl-adenosi...

Compound Q&A

What precautions should be taken when handling N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1)?

When handling N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1), safety goggles and gloves should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...