Compound Q&A

What are the physical and chemical properties of N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1)?

Answer

N6-Benzoyl-2'-o-methyl-adenosine
N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1) is a crystalline compound with a molecular weight of approximately 316.3 g/mol. It has a low solubility in water, approximately 0.02 g/L at 25°C. The compound is relatively stable and reacts mainly through nucleophilic substitution. It does not readily undergo hydrolysis or oxidation under normal conditions.

About

CAS No 85079-00-1
English Name N6-Benzoyl-2'-o-methyl-adenosine
Molecular Formula C18H19N5O5
Molecular Weight 385.38 g/mol
SMILES OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=CN=C3NC(C4=CC=CC=C4)=O)O1)OC)O
InChIKey PHFHSPQCDRKMQJ-XWXWGSFUSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1) typically synthesized?

N6-Benzoyl-2'-o-methyl-adenosine is typically synthesized by the benzoylation of 2'-o-methyl-adenosi...

Compound Q&A

What industries use N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1)?

N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1)?

When handling N6-Benzoyl-2'-o-methyl-adenosine (CAS: 85079-00-1), safety goggles and gloves should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...